| Product Name | NN-Anilinediacetic Acid |
| CAS No. | 1137-73-1 |
| Synonyms | NN-Di(carboxymethyl)aniline; N-Phenyliminodiacetic acid; N-(Carboxymethyl)-N-phenylglycine; 2,2'-(phenylimino)diacetic acid; 2,2'-(phenylimino)diacetate |
| InChI | InChI=1/C10H11NO4/c12-9(13)6-11(7-10(14)15)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13)(H,14,15)/p-2 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.1839 |
| Boiling point | 451.2°C at 760 mmHg |
| Flash point | 226.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1137-73-1 nn-anilinediacetic acid
service@apichina.com