| Product Name | Nitrophenylphenol |
| CAS No. | 885-82-5 |
| Synonyms | 4-Hydroxy-3-Nitrodiphenyl; 3-nitrobiphenyl-4-ol |
| InChI | InChI=1/C12H9NO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14H |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.2048 |
| Density | 1.304g/cm3 |
| Boiling point | 338.5°C at 760 mmHg |
| Flash point | 145.1°C |
| Refractive index | 1.637 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
885-82-5 nitrophenylphenol
service@apichina.com