| Product Name | Nitrobenzene |
| CAS No. | 98-95-3 |
| Synonyms | Benzene,nitro-; Essence of Mirbane; essenceofmirbane; NCI-C60082; Nitrobenzeen; Nitrobenzen; nitro-benzen; Oil of Myrbane-; 1-nitrobenzene |
| InChI | InChI=1/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 |
| Density | 1.205 |
| Melting point | 5-6℃ |
| Boiling point | 210-211℃ |
| Flash point | 88℃ |
| Water solubility | slightly soluble |
| Refractive index | 1.5503-1.5523 |
| Hazard Symbols |  T:Toxic;  N:Dangerous for the environment; |
| Risk Codes | R23/24/25:; R40:; R48/23/24:; R51/53:; R62:; |
| Safety | S28A:; S36/37:; S45:; S61:; |
98-95-3 nitrobenzene
service@apichina.com