| Product Name | Nitrilotriacetic acid, trisodium salt, monohydrate |
| CAS No. | 18662-53-8 |
| Synonyms | Nitrilotriacetic acid trisodium salt monohydrate; Nitriloacetic acid trisodium salt monohydrate; sodium 2,2',2''-nitrilotriacetate hydrate (3:1:1); NTA-3Na monohydrate |
| InChI | InChI=1/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3 |
| Molecular Formula | C6H8NNa3O7 |
| Molecular Weight | 275.0995 |
| Melting point | 320℃ |
| Boiling point | 498.2°C at 760 mmHg |
| Flash point | 255.1°C |
| Hazard Symbols | |
| Risk Codes | R22:Harmful if swallowed.; R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
18662-53-8 nitrilotriacetic acid, trisodium salt, monohydrate
service@apichina.com