| Product Name | Nitrilotriacetic acid, disodium salt |
| CAS No. | 15467-20-6 |
| Synonyms | disodium hydrogen nitrilotriacetate; disodium [(carboxylatomethyl)(carboxymethyl)amino]acetate; 2,2'-[(carboxymethyl)imino]diacetate (non-preferred name); acetate, 2,2',2''-nitrilotris-, sodium salt (1:2) |
| InChI | InChI=1/C6H9NO6.2Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;/q;2*+1/p-3 |
| Molecular Formula | C6H6NNa2O6 |
| Molecular Weight | 234.095 |
| Melting point | 300℃ |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
15467-20-6 nitrilotriacetic acid, disodium salt
service@apichina.com