| Product Name | nicotinic acid, compound with 2-aminoethanol (1:1) |
| CAS No. | 3570-15-8 |
| Synonyms | Neopeviton; Nicotinic acid monoethanolamine salt; 2-Aminoethanol compd. with nicotinic acid; Ethanolamine nicotinate; Monoethanolamine nicotinate; Neo-periton; Nicamin; Nicatol; Nikatol; 3-Pyridinecarboxylic acid, compd. with 2-aminoethanol (1:1) (9CI); Nicotinic acid, compd. with 2-aminoethanol (1:1); Nicotinic acid, compound with 2-aminoethanol (1:1); pyridine-3-carboxylic acid - 2-aminoethanol (1:1) |
| InChI | InChI=1/C6H5NO2.C2H7NO/c8-6(9)5-2-1-3-7-4-5;3-1-2-4/h1-4H,(H,8,9);4H,1-3H2 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.1925 |
| Boiling point | 292.5°C at 760 mmHg |
| Flash point | 130.7°C |
3570-15-8 nicotinic acid, compound with 2-aminoethanol (1:1)
service@apichina.com
- Next：3570-21-6 4-methyl-l-norleucine
- Previous：3570-10-3 benorterone