| Product Name | Nicotine ditartrate dihydrate |
| CAS No. | 6019-06-3 |
| Synonyms | (-)-Nicotine di-(+)-hydrogen tartrate; N-[(3Z)-3-(5-chloro-1,3-benzoxazol-2(3H)-ylidene)-4-oxocyclohexa-1,5-dien-1-yl]-2-methylpropanamide |
| InChI | InChI=1/C17H15ClN2O3/c1-9(2)16(22)19-11-4-5-14(21)12(8-11)17-20-13-7-10(18)3-6-15(13)23-17/h3-9,20H,1-2H3,(H,19,22)/b17-12- |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.7656 |
| Density | 1.38g/cm3 |
| Melting point | 97-100℃ |
| Boiling point | 469.8°C at 760 mmHg |
| Flash point | 238°C |
| Refractive index | 1.646 |
| Hazard Symbols | |
| Risk Codes | R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S13:Keep away from food, drink and animal feeding stuffs.; S28A:After contact with skin, wash immediately with plenty of water.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
6019-06-3 nicotine ditartrate dihydrate
service@apichina.com