| Product Name | Nicothiazone |
| CAS No. | 555-90-8 |
| Synonyms | 3-Formylpyridine thiosemicarbazone; Nicotinaldehyde, thiocarbohydrazone; Nicotinaldehyde thiosemicarbazone; Pyridine-3-carboxaldehyde, thiosemicarbazone; ; 2-(pyridin-3-ylmethylidene)hydrazinecarbothioamide; pyridine-3-carbaldehyde thiosemicarbazone; Pyridine-3-aldehyde thiosemicarbazone |
| InChI | InChI=1/C7H8N4S/c8-7(12)11-10-5-6-2-1-3-9-4-6/h1-5H,(H3,8,11,12)/b10-5+ |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.2302 |
| Density | 1.32g/cm3 |
| Boiling point | 346.5°C at 760 mmHg |
| Flash point | 163.3°C |
| Refractive index | 1.665 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
555-90-8 nicothiazone
service@apichina.com