| Product Name | Naphthalene-d8 |
| CAS No. | 1146-65-2 |
| InChI | InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| Molecular Formula | C10D8 |
| Molecular Weight | 136.2198 |
| Density | 1.102g/cm3 |
| Melting point | 81-83℃ |
| Boiling point | 221.5°C at 760 mmHg |
| Flash point | 78.9°C |
| Refractive index | 1.632 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
1146-65-2 naphthalene-d8
service@apichina.com