| Product Name | namoxyrate |
| CAS No. | 1234-71-5 |
| Synonyms | Namoxyrate [USAN:INN]; (1,1'-Biphenyl)-4-acetic acid, alpha-ethyl-, compd. with 2-(dimethylamino)ethanol (1:1); 2-(4-Biphenyl)butyric acid compd. with 2-(dimethylamino)ethanol; 2-Dimethylaminoethanol 2-(4-biphenylyl)butyrat; Butyric acid, 2-(4-biphenylyl)-, compd. with 2-(dimethylamino)ethanol; Namol xenyrate; Namoxirato; Namoxirato [INN-Spanish]; Namoxyrate; Namoxyratum; Namoxyratum [INN-Latin]; UNII-38IDB6L05D; W 1760A; W 1769A; alpha-Ethyl-4-biphenylacetic acid, compound with 2-dimethylaminoethanol (1:1); 4-Biphenylacetic acid, alpha-ethyl-, compd. with 2-(dimethylamino)ethanol (1:1); 4-(biphenyl-4-yl)-2-methylbutanoic acid - 2-(dimethylamino)ethanol (1:1) |
| InChI | InChI=1/C17H18O2.C4H11NO/c1-13(17(18)19)7-8-14-9-11-16(12-10-14)15-5-3-2-4-6-15;1-5(2)3-4-6/h2-6,9-13H,7-8H2,1H3,(H,18,19);6H,3-4H2,1-2H3 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.4599 |
| Boiling point | 419.5°C at 760 mmHg |
| Flash point | 316.2°C |
1234-71-5 namoxyrate
service@apichina.com