| Product Name | N1-[4-(allyloxy)phenyl]acetamide |
| CAS No. | 6622-73-7 |
| Synonyms | 4-Allyloxyacetanilide,98%; N-[4-(prop-2-en-1-yloxy)phenyl]acetamide |
| InChI | InChI=1/C11H13NO2/c1-3-8-14-11-6-4-10(5-7-11)12-9(2)13/h3-7H,1,8H2,2H3,(H,12,13) |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.2264 |
| Density | 1.095g/cm3 |
| Melting point | 90℃ |
| Boiling point | 377°C at 760 mmHg |
| Flash point | 181.8°C |
| Refractive index | 1.556 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6622-73-7 n1-[4-(allyloxy)phenyl]acetamide
service@apichina.com