| Product Name | N1-[2-(oxiran-2-ylmethoxy)phenyl]acetamide |
| CAS No. | 57682-11-8 |
| Synonyms | N-[2-(oxiran-2-ylmethoxy)phenyl]acetamide |
| InChI | InChI=1/C11H13NO3/c1-8(13)12-10-4-2-3-5-11(10)15-7-9-6-14-9/h2-5,9H,6-7H2,1H3,(H,12,13) |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.2258 |
| Density | 1.242g/cm3 |
| Boiling point | 383.8°C at 760 mmHg |
| Flash point | 185.9°C |
| Refractive index | 1.586 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
57682-11-8 n1-[2-(oxiran-2-ylmethoxy)phenyl]acetamide
service@apichina.com