| Product Name | N1-(2-Chlorophenyl)-2-bromoacetamide |
| CAS No. | 5439-11-2 |
| Synonyms | 2-bromo-N-(2-chlorophenyl)acetamide |
| InChI | InChI=1/C8H7BrClNO/c9-5-8(12)11-7-4-2-1-3-6(7)10/h1-4H,5H2,(H,11,12) |
| Molecular Formula | C8H7BrClNO |
| Molecular Weight | 248.5043 |
| Density | 1.683g/cm3 |
| Melting point | 84℃ |
| Boiling point | 372.1°C at 760 mmHg |
| Flash point | 178.8°C |
| Refractive index | 1.639 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5439-11-2 n1-(2-chlorophenyl)-2-bromoacetamide
service@apichina.com