| Product Name | N1-(2,4-dichlorophenyl)benzamide |
| CAS No. | 10286-76-7 |
| Synonyms | N-(2,4-dichlorophenyl)benzamide |
| InChI | InChI=1/C13H9Cl2NO/c14-10-6-7-12(11(15)8-10)16-13(17)9-4-2-1-3-5-9/h1-8H,(H,16,17) |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.1227 |
| Density | 1.384g/cm3 |
| Boiling point | 300.4°C at 760 mmHg |
| Flash point | 135.5°C |
| Refractive index | 1.656 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
10286-76-7 n1-(2,4-dichlorophenyl)benzamide
service@apichina.com