| Product Name | N1-(2,2-diethoxyethyl)-4-fluoroaniline |
| CAS No. | 239085-97-3 |
| Synonyms | N-(2,2-Diethoxyethyl)-4-fluoroaniline |
| InChI | InChI=1/C12H18FNO2/c1-3-15-12(16-4-2)9-14-11-7-5-10(13)6-8-11/h5-8,12,14H,3-4,9H2,1-2H3 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.2752 |
| Density | 1.089g/cm3 |
| Boiling point | 323.57°C at 760 mmHg |
| Flash point | 149.49°C |
| Refractive index | 1.51 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
239085-97-3 n1-(2,2-diethoxyethyl)-4-fluoroaniline
service@apichina.com