| Product Name | n-Tetradecylboronic acid |
| CAS No. | 100888-40-2 |
| Synonyms | Myristylboronic acid~n-Tetradecaneboronic acid; tetradecylboronic acid |
| InChI | InChI=1/C14H31BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h16-17H,2-14H2,1H3 |
| Molecular Formula | C14H31BO2 |
| Molecular Weight | 242.2057 |
| Density | 0.875g/cm3 |
| Boiling point | 360.9°C at 760 mmHg |
| Flash point | 172.1°C |
| Refractive index | 1.443 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
100888-40-2 n-tetradecylboronic acid
service@apichina.com