| Product Name | N,S-diacetyl-L-cysteine methyl ester |
| CAS No. | 19547-88-7 |
| Synonyms | N,S-Diacetylcysteine methyl ester; Methyl N,S-diacetyl-L-cysteinate |
| InChI | InChI=1/C8H13NO4S/c1-5(10)9-7(8(12)13-3)4-14-6(2)11/h7H,4H2,1-3H3,(H,9,10)/t7-/m0/s1 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.2581 |
| Density | 1.208g/cm3 |
| Melting point | 97-100℃ |
| Boiling point | 379.4°C at 760 mmHg |
| Flash point | 183.3°C |
| Refractive index | 1.49 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
19547-88-7 n,s-diacetyl-l-cysteine methyl ester
service@apichina.com