| Product Name | n-Propylthiourea |
| CAS No. | 927-67-3 |
| Synonyms | Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
| InChI | InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
| Molecular Formula | C4H10N2S |
| Molecular Weight | 118.2006 |
| Density | 1.054g/cm3 |
| Boiling point | 182.1°C at 760 mmHg |
| Flash point | 63.9°C |
| Refractive index | 1.537 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
927-67-3 n-propylthiourea
service@apichina.com