| Product Name | N-Propylmaleimide |
| CAS No. | 21746-40-7 |
| Synonyms | N-(n-Propyl)maleimide; 1-(n-Propyl)-1H-pyrrole-2,5-dione; 1-propyl-1H-pyrrole-2,5-dione |
| InChI | InChI=1/C7H9NO2/c1-2-5-8-6(9)3-4-7(8)10/h3-4H,2,5H2,1H3 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.1519 |
| Density | 1.158g/cm3 |
| Boiling point | 226.6°C at 760 mmHg |
| Flash point | 95°C |
| Refractive index | 1.508 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
21746-40-7 n-propylmaleimide
service@apichina.com