| Product Name | n-Propyl 3-mercaptopropionate |
| CAS No. | 165804-07-9 |
| Synonyms | 3-Mercaptopropionic acid n-propyl ester; propyl 3-sulfanylpropanoate |
| InChI | InChI=1/C6H12O2S/c1-2-4-8-6(7)3-5-9/h9H,2-5H2,1H3 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.2233 |
| Density | 1.021g/cm3 |
| Boiling point | 196.6°C at 760 mmHg |
| Flash point | 79°C |
| Refractive index | 1.456 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
165804-07-9 n-propyl 3-mercaptopropionate
service@apichina.com