| Product Name | N-Phenylurethane |
| CAS No. | 101-99-5 |
| Synonyms | Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.136g/cm3 |
| Boiling point | 238°C at 760 mmHg |
| Flash point | 79.2°C |
| Refractive index | 1.558 |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
101-99-5 n-phenylurethane
service@apichina.com