| Product Name | N-Phenylbenzamidine |
| CAS No. | 1527-91-9 |
| Synonyms | N1-Phenylbenzene-1-carboximidamide; N'-phenylbenzenecarboximidamide; N-[(1Z)-amino(phenyl)methylidene]anilinium |
| InChI | InChI=1/C13H12N2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15)/p+1 |
| Molecular Formula | C13H13N2 |
| Molecular Weight | 197.2552 |
| Melting point | 118-120℃ |
| Boiling point | 346.3°C at 760 mmHg |
| Flash point | 163.3°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1527-91-9 n-phenylbenzamidine
service@apichina.com