| Product Name | n-Octylboronic acid |
| CAS No. | 28741-08-4 |
| Synonyms | Caprylboronic acid; n-Octaneboronic acid; octylboronic acid; 1-Octylboronic acid |
| InChI | InChI=1/C8H19BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-8H2,1H3 |
| Molecular Formula | C8H19BO2 |
| Molecular Weight | 158.0463 |
| Density | 0.89g/cm3 |
| Boiling point | 262.6°C at 760 mmHg |
| Flash point | 112.6°C |
| Refractive index | 1.427 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
28741-08-4 n-octylboronic acid
service@apichina.com