| Product Name | N-n-Propylmaleamicacid |
| CAS No. | 36342-07-1 |
| Synonyms | N-(n-Propyl)maleamic acid; Maleic acid mono-n-propylamide; (2Z)-4-oxo-4-(propylamino)but-2-enoic acid; (2E)-4-oxo-4-(propylamino)but-2-enoic acid |
| InChI | InChI=1/C7H11NO3/c1-2-5-8-6(9)3-4-7(10)11/h3-4H,2,5H2,1H3,(H,8,9)(H,10,11)/b4-3+ |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.1671 |
| Density | 1.136g/cm3 |
| Boiling point | 376.4°C at 760 mmHg |
| Flash point | 181.5°C |
| Refractive index | 1.486 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
36342-07-1 n-n-propylmaleamicacid
service@apichina.com