| Product Name | N-(n-Octyl)-n-pentylamine |
| CAS No. | 6835-13-8 |
| Synonyms | N-(n-Amyl)-n-octylamine; 2-{4-[(4-chloro-2-methylphenyl)carbamoyl]phenoxy}propanoatato |
| InChI | InChI=1/C17H16ClNO4/c1-10-9-13(18)5-8-15(10)19-16(20)12-3-6-14(7-4-12)23-11(2)17(21)22/h3-9,11H,1-2H3,(H,19,20)(H,21,22)/p-1 |
| Molecular Formula | C17H15ClNO4 |
| Molecular Weight | 332.7588 |
| Boiling point | 439.8°C at 760 mmHg |
| Flash point | 219.8°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
6835-13-8 n-(n-octyl)-n-pentylamine
service@apichina.com