| Product Name | N,N-Dimethylthioformamide |
| CAS No. | 758-16-7 |
| Synonyms | NN-Dimethylthioformamide |
| InChI | InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
| Molecular Formula | C3H7NS |
| Molecular Weight | 89.1594 |
| Density | 0.985g/cm3 |
| Boiling point | 224.9°C at 760 mmHg |
| Flash point | 89.8°C |
| Refractive index | 1.511 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
758-16-7 n,n-dimethylthioformamide
service@apichina.com