| Product Name | N,N-dimethylaminomethylferrocene |
| CAS No. | 1271-86-9 |
| Synonyms | N,N-dimethylaminomethyl ferrocene; FERROCENYLMETHYLDIMETHYLAMINE; DimethylaminomethylFERROCENCE; CYCLOPENTADIENYL(Dimethylaminomethyl)CYCLOPENTADLENYL IRON; (DIMETHYLAMINO)METHYL]-ferrocen; (Dimethylaminomethyl)ferrocene; iron(2+) cyclopenta-2,4-dienide 2-[(dimethylamino)methyl]cyclopenta-2,4-dienide (1:1:1); cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanaminium |
| InChI | InChI=1/C8H13N/c1-9(2)7-8-5-3-4-6-8/h3-6,8H,7H2,1-2H3/p+1 |
| Molecular Formula | C8H14N |
| Molecular Weight | 124.2029 |
| Boiling point | 152.9°C at 760 mmHg |
| Flash point | 38.6°C |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1271-86-9 n,n-dimethylaminomethylferrocene
service@apichina.com
- Next:1271-94-9 butyrylferrocene
- Previous:1271-79-0 propionylferrocene