| Product Name | N,N-Dimethyl-4-nitrosoaniline |
| CAS No. | 138-89-6 |
| Synonyms | 4-Nitroso-N,N-dimethylaniline; p-Nitrosodimethylaniline |
| InChI | InChI=1/C8H10N2O/c1-10(2)8-5-3-7(9-11)4-6-8/h3-6H,1-2H3 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.1778 |
| Density | 1.04g/cm3 |
| Melting point | 83-86 °C |
| Boiling point | 258.7°C at 760 mmHg |
| Flash point | 110.3°C |
| Refractive index | 1.529 |
| Hazard Symbols |  F:Highly flammable;  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; R8:Contact with combustible material may cause fire.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S37:Wear suitable gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
138-89-6 n,n-dimethyl-4-nitrosoaniline
service@apichina.com