| Product Name | N,N-Dimethyl-2-phenyl(thioacetamide) |
| CAS No. | 17709-95-4 |
| Synonyms | N,N-dimethyl-2-phenylethanethioamide |
| InChI | InChI=1/C10H13NS/c1-11(2)10(12)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.2819 |
| Density | 1.07g/cm3 |
| Boiling point | 262.9°C at 760 mmHg |
| Flash point | 112.8°C |
| Refractive index | 1.584 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
17709-95-4 n,n-dimethyl-2-phenyl(thioacetamide)
service@apichina.com