| Product Name | N,N-Diethylbenzamide |
| CAS No. | 1696-17-9 |
| Synonyms | Rebemide; 4-09-00-00728 (Beilstein Handbook Reference); AI3-01197; BRN 1909505; Benzoic acid N,N-diethylamide; Benzoic acid diethylamide; Benzoyldiethylamine; NSC 16060; R 2; R 2 (VAN); R 2 (insect repellant); R 2 (insect repellent); R2; REP; Rebemid; Benzamide, N,N-diethyl- |
| InChI | InChI=1/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.2429 |
| Density | 0.997g/cm3 |
| Boiling point | 288.7°C at 760 mmHg |
| Flash point | 125.5°C |
| Refractive index | 1.518 |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
1696-17-9 n,n-diethylbenzamide
service@apichina.com