| Product Name | N,N-bis(2,3-epoxypropyl)-o-toluidine |
| CAS No. | 40027-50-7 |
| Synonyms | 2-Oxiranemethanamine, N-(2-methylphenyl)-N-(2-oxiranylmethyl)-; Diglycidyl-o-toluidine; N,N-Diglycidyl-o-toluidine; NSC 269836; N,N-Bis(2,3-epoxypropyl)-o-toluidine; Oxiranemethanamine, N-(2-methylphenyl)-N-(oxiranylmethyl)-; 2-methyl-N,N-bis(oxiran-2-ylmethyl)aniline |
| InChI | InChI=1/C13H17NO2/c1-10-4-2-3-5-13(10)14(6-11-8-15-11)7-12-9-16-12/h2-5,11-12H,6-9H2,1H3 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.2796 |
| Density | 1.189g/cm3 |
| Boiling point | 343.1°C at 760 mmHg |
| Flash point | 134.6°C |
| Refractive index | 1.6 |
40027-50-7 n,n-bis(2,3-epoxypropyl)-o-toluidine
service@apichina.com