| Product Name | N-Methylnicotinamide |
| CAS No. | 114-33-0 |
| Synonyms | Methylnicotinamide; N-methylpyridine-3-carboxamide |
| InChI | InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.1512 |
| Density | 1.106g/cm3 |
| Melting point | 100-105℃ |
| Boiling point | 347.7°C at 760 mmHg |
| Flash point | 164.1°C |
| Refractive index | 1.529 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
114-33-0 n-methylnicotinamide
service@apichina.com
- Next:114-38-5 n-(2-chlorophenyl)-urea
- Previous:114-32-9 (2-ethylphenyl)urea