| Product Name | N-Methylcarbostyril |
| CAS No. | 606-43-9 |
| Synonyms | 2-Hydroxy-1-methylquinoline; N-Methylcarbostyril; 1-methylquinolin-2(1H)-one; 1-methyl-2-Quinolinone |
| InChI | InChI=1/C10H9NO/c1-11-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.1846 |
| Density | 1.16g/cm3 |
| Boiling point | 247.5°C at 760 mmHg |
| Flash point | 106.8°C |
| Refractive index | 1.592 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
606-43-9 n-methylcarbostyril
service@apichina.com
- Next:606-45-1 methyl o-anisate
- Previous:606-41-7 2-amino-1-naphthol