| Product Name | N-methyl-N-phenylthiourea |
| CAS No. | 4104-75-0 |
| Synonyms | 1-Methyl-1-phenylthiourea |
| InChI | InChI=1/C8H10N2S/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.2434 |
| Density | 1.221g/cm3 |
| Melting point | 101℃ |
| Boiling point | 267.1°C at 760 mmHg |
| Flash point | 115.3°C |
| Refractive index | 1.679 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S37/39:Wear suitable gloves and eye/face protection.; |
4104-75-0 n-methyl-n-phenylthiourea
service@apichina.com