| Product Name | N-Methyl-4-(2-chloroacetamido)benzoic acid |
| CAS No. | 147149-44-8 |
| Synonyms | 4-Carboxy-N-methyl-alpha-chloroacetanilide; 4-[(chloroacetyl)(methyl)amino]benzoic acid |
| InChI | InChI=1/C10H10ClNO3/c1-12(9(13)6-11)8-4-2-7(3-5-8)10(14)15/h2-5H,6H2,1H3,(H,14,15) |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.6443 |
| Density | 1.379g/cm3 |
| Boiling point | 401°C at 760 mmHg |
| Flash point | 196.3°C |
| Refractive index | 1.607 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
147149-44-8 n-methyl-4-(2-chloroacetamido)benzoic acid
service@apichina.com