| Product Name | N-Methyl-2-nitroaniline |
| CAS No. | 612-28-2 |
| Synonyms | Benzenamine, N-methyl-2-nitro-; 2-Nitro-N-methylaniline; 4-12-00-01564 (Beilstein Handbook Reference); Aniline, N-methyl-o-nitro-; BRN 2209110; N-Methyl-2-nitrobenzenamine; N-Methyl-o-nitroaniline; NSC 86672; o-(Methylamino)nitrobenzene; o-Nitro-N-methylaniline |
| InChI | InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.1506 |
| Density | 1.26g/cm3 |
| Melting point | 33-37℃ |
| Boiling point | 277.9°C at 760 mmHg |
| Flash point | 121.9°C |
| Refractive index | 1.619 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
612-28-2 n-methyl-2-nitroaniline
service@apichina.com