| Product Name | N-Methyl-1,4-phenylenediamine dihydrochloride |
| CAS No. | 5395-70-0 |
| Synonyms | 4-ammonio-N-methylanilinium dichloride; N-Methyl-p-phenylenediamine dihydrochloride; N-methylbenzene-1,4-diamine dihydrochloride |
| InChI | InChI=1/C7H10N2.2ClH/c1-9-7-4-2-6(8)3-5-7;;/h2-5,9H,8H2,1H3;2*1H |
| Molecular Formula | C7H12Cl2N2 |
| Molecular Weight | 195.0896 |
| Boiling point | 258.8°C at 760 mmHg |
| Flash point | 127.1°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
5395-70-0 n-methyl-1,4-phenylenediamine dihydrochloride
service@apichina.com