| Product Name | N-Hydroxy-1,8-naphthalimide sodium salt |
| CAS No. | 6207-89-2 |
| Synonyms | N,N-(1,8-Naphthalyl)hydroxylamine sodium salt; 1,3-dioxo-1,3-dihydro-2H-benzo[e]isoindol-2-olate |
| InChI | InChI=1/C12H6NO3/c14-11-9-6-5-7-3-1-2-4-8(7)10(9)12(15)13(11)16/h1-6H/q-1 |
| Molecular Formula | C12H6NO3 |
| Molecular Weight | 212.1815 |
| Boiling point | 472.1°C at 760 mmHg |
| Flash point | 239.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6207-89-2 n-hydroxy-1,8-naphthalimide sodium salt
service@apichina.com