| Product Name | n-Hexylthiourea |
| CAS No. | 21071-27-2 |
| Synonyms | 1-hexylthiourea |
| InChI | InChI=1/C7H16N2S/c1-2-3-4-5-6-9-7(8)10/h2-6H2,1H3,(H3,8,9,10) |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.2803 |
| Density | 0.992g/cm3 |
| Boiling point | 240.8°C at 760 mmHg |
| Flash point | 99.4°C |
| Refractive index | 1.517 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
21071-27-2 n-hexylthiourea
service@apichina.com