| Product Name | n-Hexyl isothiocyanate |
| CAS No. | 4404-45-9 |
| Synonyms | 1-Hexyl isothiocyanate; 1-Isothiocyanatohexane; 2-isothiocyanatohexane |
| InChI | InChI=1/C7H13NS/c1-3-4-5-7(2)8-6-9/h7H,3-5H2,1-2H3 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.2498 |
| Density | 0.91g/cm3 |
| Boiling point | 205.9°C at 760 mmHg |
| Flash point | 74°C |
| Refractive index | 1.484 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4404-45-9 n-hexyl isothiocyanate
service@apichina.com