| Product Name | N-Ethylmaleamic acid |
| CAS No. | 4166-67-0 |
| Synonyms | Maleic acid monoethylamide; (2E)-4-(ethylamino)-4-oxobut-2-enoic acid; (2Z)-4-(ethylamino)-4-oxobut-2-enoic acid |
| InChI | InChI=1/C6H9NO3/c1-2-7-5(8)3-4-6(9)10/h3-4H,2H2,1H3,(H,7,8)(H,9,10)/b4-3- |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.1406 |
| Density | 1.175g/cm3 |
| Melting point | 123-125℃ |
| Boiling point | 375°C at 760 mmHg |
| Flash point | 180.6°C |
| Refractive index | 1.488 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4166-67-0 n-ethylmaleamic acid
service@apichina.com