| Product Name | N-Ethyldiethanolamine |
| CAS No. | 139-87-7 |
| Synonyms | 2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
| InChI | InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
| Molecular Formula | C6H16NO2 |
| Molecular Weight | 134.1962 |
| Melting point | -50℃ |
| Boiling point | 246.4°C at 760 mmHg |
| Flash point | 123.9°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
139-87-7 n-ethyldiethanolamine
service@apichina.com