| Product Name | N-E-Z-L-lysine methyl ester hydrochloride |
| CAS No. | 27894-50-4 |
| Synonyms | N(epsilon)-Cbz-L-lysine methyl ester hydrochloride; methyl N6-benzyloxycarbonyl-L-lysinate hydrochloride; H-Lys(Z)-OMe.HCl; H-Lys(Z)-OMe*HCl; N(epsilon)-Benzyloxycarbonyl-L-lysine methyl ester hydrochloride; H-Lys(Z)-OMe hydrochloride; N-epsolin-Benzyloxycarbonyl-L-lysine methyl ester hydrochloride; methyl N~6~-[(benzyloxy)carbonyl]lysinate hydrochloride (1:1); methyl N~6~-[(benzyloxy)carbonyl]lysinate; H-Lys(Z)-Ome Hcl; H-Lys(Z)-OMe・HCl; Nepsilon-Benzyloxycarbonyl-L-Lysine Methyl Ester Hydrochloride |
| InChI | InChI=1/C15H22N2O4/c1-20-14(18)13(16)9-5-6-10-17-15(19)21-11-12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-11,16H2,1H3,(H,17,19) |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.3462 |
| Density | 1.142g/cm3 |
| Melting point | 115-118℃ |
| Boiling point | 444.6°C at 760 mmHg |
| Flash point | 222.7°C |
| Refractive index | 1.524 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
27894-50-4 n-e-z-l-lysine methyl ester hydrochloride
service@apichina.com