| Product Name | N-Dodecylguanidine terephthalate |
| CAS No. | 19727-17-4 |
| Synonyms | Guanidine, dodecyl-, terephthalate (2:1); Caswell No. 418AA; Dodecylguanidine terephthalate; EPA Pesticide Chemical Code 044302; Terephthalic acid dodecylguanidine salt (1:2); 1,4-Benzenedicarboxylic acid, compd. with dodecylguanidine (1:2); Terephthalic acid, compd. with dodecylguanidine (1:2); benzene-1,4-dicarboxylic acid - 2-dodecylguanidine (1:1) |
| InChI | InChI=1/C13H29N3.C8H6O4/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15;9-7(10)5-1-2-6(4-3-5)8(11)12/h2-12H2,1H3,(H4,14,15,16);1-4H,(H,9,10)(H,11,12) |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.5203 |
| Boiling point | 352.8°C at 760 mmHg |
| Flash point | 167.2°C |
19727-17-4 n-dodecylguanidine terephthalate
service@apichina.com