| Product Name | n-Dodecylboronic acid |
| CAS No. | 3088-79-7 |
| Synonyms | n-Dodecaneboronic acid~Laurylboronic acid; dodecylboronic acid |
| InChI | InChI=1/C12H27BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h14-15H,2-12H2,1H3 |
| Molecular Formula | C12H27BO2 |
| Molecular Weight | 214.1526 |
| Density | 0.879g/cm3 |
| Boiling point | 329.8°C at 760 mmHg |
| Flash point | 153.2°C |
| Refractive index | 1.439 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3088-79-7 n-dodecylboronic acid
service@apichina.com