| Product Name | n-Decylboronic acid |
| CAS No. | 24464-63-9 |
| Synonyms | n-Decaneboronic acid; decylboronic acid |
| InChI | InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3 |
| Molecular Formula | C10H23BO2 |
| Molecular Weight | 186.0994 |
| Density | 0.883g/cm3 |
| Boiling point | 297.1°C at 760 mmHg |
| Flash point | 133.5°C |
| Refractive index | 1.434 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
24464-63-9 n-decylboronic acid
service@apichina.com