| Product Name | N-chloroacetylglycine |
| CAS No. | 6319-96-6 |
| Synonyms | Chloroac-Gly-OH; Chloroacetylglycine; N-(Chloroacetyl)glycine; N-Chloroacetyl glycine |
| InChI | InChI=1/C4H6ClNO3/c5-1-3(7)6-2-4(8)9/h1-2H2,(H,6,7)(H,8,9) |
| Molecular Formula | C4H6ClNO3 |
| Molecular Weight | 151.5483 |
| Density | 1.422g/cm3 |
| Boiling point | 431.6°C at 760 mmHg |
| Flash point | 214.8°C |
| Refractive index | 1.486 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6319-96-6 n-chloroacetylglycine
service@apichina.com