| Product Name | N-(Carboethoxymethyl)piperazine |
| CAS No. | 40004-08-8 |
| Synonyms | Ethyl (1-piperazino)acetate; (1-Piperazino)acetic acid ethyl ester; 1-(Ethoxycarbonylmethyl)piperazine; ethyl piperazin-1-ylacetate; Ethyl 1-piperazinylacetate |
| InChI | InChI=1/C8H16N2O2/c1-2-12-8(11)7-10-5-3-9-4-6-10/h9H,2-7H2,1H3 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.2248 |
| Density | 1.027g/cm3 |
| Boiling point | 252.5°C at 760 mmHg |
| Flash point | 106.5°C |
| Refractive index | 1.457 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
40004-08-8 n-(carboethoxymethyl)piperazine
service@apichina.com