| Product Name | N-Carbamoylmaleamic acid |
| CAS No. | 105-61-3 |
| Synonyms | Maleuric acid; Maleic acid monoureide~Maleuric acid; (2Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid; (2E)-4-(carbamoylamino)-4-oxobut-2-enoic acid; 4-(carbamoylamino)-4-oxobut-2-enoate |
| InChI | InChI=1/C5H6N2O4/c6-5(11)7-3(8)1-2-4(9)10/h1-2H,(H,9,10)(H3,6,7,8,11)/p-1 |
| Molecular Formula | C5H5N2O4 |
| Molecular Weight | 157.1047 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
105-61-3 n-carbamoylmaleamic acid
service@apichina.com