| Product Name | N-Bromophthalimide |
| CAS No. | 2439-85-2 |
| Synonyms | AI3-18212; NSC 3525; 1H-Isoindole-1,3(2H)-dione, 2-bromo-; 2-bromo-1H-isoindole-1,3(2H)-dione |
| InChI | InChI=1/C8H4BrNO2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | 226.0269 |
| Density | 1.932g/cm3 |
| Melting point | 199-203℃ |
| Boiling point | 332.3°C at 760 mmHg |
| Flash point | 154.8°C |
| Refractive index | 1.704 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2439-85-2 n-bromophthalimide
service@apichina.com